C15H11N3O3S — CID 46225703
6-methyl-7-[(E)-thiophen-2-ylmethylideneamino]-[1,3]dioxolo[4,5-g]quinazolin-8-one (PubChem CID 46225703) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is 6-methyl-7-[(E)-thiophen-2-ylmethylideneamino]-[1,3]dioxolo[4,5-g]quinazolin-8-one.
| Compound Name | 6-methyl-7-[(E)-thiophen-2-ylmethylideneamino]-[1,3]dioxolo[4,5-g]quinazolin-8-one |
|---|---|
| PubChem CID | 46225703 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 6-methyl-7-[(E)-thiophen-2-ylmethylideneamino]-[1,3]dioxolo[4,5-g]quinazolin-8-one |
| SMILES | Cc1nc2cc3c(cc2c(=O)n1/N=C/c1cccs1)OCO3 |
| InChI | InChI=1S/C15H11N3O3S/c1-9-17-12-6-14-13(20-8-21-14)5-11(12)15(19)18(9)16-7-10-3-2-4-22-10/h2-7H,8H2,1H3/b16-7+ |
| InChIKey | PXKOGGMIWVMSOM-FRKPEAEDSA-N |
| XLogP | 2.38 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|