C21H17N3O2S — CID 6901031
2-[(2-methylphenoxy)methyl]-3-[(E)-thiophen-2-ylmethylideneamino]quinazolin-4-one (PubChem CID 6901031) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[(2-methylphenoxy)methyl]-3-[(E)-thiophen-2-ylmethylideneamino]quinazolin-4-one.
| Compound Name | 2-[(2-methylphenoxy)methyl]-3-[(E)-thiophen-2-ylmethylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 6901031 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-[(2-methylphenoxy)methyl]-3-[(E)-thiophen-2-ylmethylideneamino]quinazolin-4-one |
| SMILES | Cc1ccccc1OCc1nc2ccccc2c(=O)n1/N=C/c1cccs1 |
| InChI | InChI=1S/C21H17N3O2S/c1-15-7-2-5-11-19(15)26-14-20-23-18-10-4-3-9-17(18)21(25)24(20)22-13-16-8-6-12-27-16/h2-13H,14H2,1H3/b22-13+ |
| InChIKey | HWZOUFYRESOUKE-LPYMAVHISA-N |
| XLogP | 4.23 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|