C34H34N2O6 — CID 91174894
5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methylaniline;6-[(E)-2-(4-methyl-3-nitrophenyl)ethenyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 91174894) has the molecular formula C34H34N2O6 and a molecular weight of 566.65 g/mol. Its IUPAC name is 5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methylaniline;6-[(E)-2-(4-methyl-3-nitrophenyl)ethenyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methylaniline;6-[(E)-2-(4-methyl-3-nitrophenyl)ethenyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 91174894 |
| Molecular Formula | C34H34N2O6 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-methylaniline;6-[(E)-2-(4-methyl-3-nitrophenyl)ethenyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1ccc(/C=C/c2ccc3c(c2)OCCO3)cc1[N+](=O)[O-].Cc1ccc(CCc2ccc3c(c2)OCCO3)cc1N |
| InChI | InChI=1S/C17H15NO4.C17H19NO2/c1-12-2-3-13(10-15(12)18(19)20)4-5-14-6-7-16-17(11-14)22-9-8-21-16;1-12-2-3-13(10-15(12)18)4-5-14-6-7-16-17(11-14)20-9-8-19-16/h2-7,10-11H,8-9H2,1H3;2-3,6-7,10-11H,4-5,8-9,18H2,1H3/b5-4+; |
| InChIKey | RSOZKSZCHYRAFA-FXRZFVDSSA-N |
| XLogP | 6.98 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|