C19H15NO6 — CID 102498390
methyl (E,2E)-2-(1,3-benzodioxol-5-ylmethylidene)-4-(2-nitrophenyl)but-3-enoate (PubChem CID 102498390) has the molecular formula C19H15NO6 and a molecular weight of 353.33 g/mol. Its IUPAC name is methyl (E,2E)-2-(1,3-benzodioxol-5-ylmethylidene)-4-(2-nitrophenyl)but-3-enoate.
| Compound Name | methyl (E,2E)-2-(1,3-benzodioxol-5-ylmethylidene)-4-(2-nitrophenyl)but-3-enoate |
|---|---|
| PubChem CID | 102498390 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | methyl (E,2E)-2-(1,3-benzodioxol-5-ylmethylidene)-4-(2-nitrophenyl)but-3-enoate |
| SMILES | COC(=O)C(/C=C/c1ccccc1[N+](=O)[O-])=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15NO6/c1-24-19(21)15(8-7-14-4-2-3-5-16(14)20(22)23)10-13-6-9-17-18(11-13)26-12-25-17/h2-11H,12H2,1H3/b8-7+,15-10+ |
| InChIKey | CDKYMFJDPOOUDK-ARADJAMMSA-N |
| XLogP | 3.59 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|