C20H23N5O3 — CID 122350756
(E)-3-(1,3-benzodioxol-5-yl)-1-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 122350756) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122350756 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCNc1ccc(N2CCN(C(=O)/C=C/c3ccc4c(c3)OCO4)CC2)nn1 |
| InChI | InChI=1S/C20H23N5O3/c1-2-21-18-6-7-19(23-22-18)24-9-11-25(12-10-24)20(26)8-4-15-3-5-16-17(13-15)28-14-27-16/h3-8,13H,2,9-12,14H2,1H3,(H,21,22)/b8-4+ |
| InChIKey | BNTSUHXLKUVNFS-XBXARRHUSA-N |
| XLogP | 2.00 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|