C26H27N5O3 — CID 122346346
(E)-3-(1,3-benzodioxol-5-yl)-1-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 122346346) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122346346 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(Nc2cc(C)nc(N3CCN(C(=O)/C=C/c4ccc5c(c4)OCO5)CC3)n2)cc1 |
| InChI | InChI=1S/C26H27N5O3/c1-18-3-7-21(8-4-18)28-24-15-19(2)27-26(29-24)31-13-11-30(12-14-31)25(32)10-6-20-5-9-22-23(16-20)34-17-33-22/h3-10,15-16H,11-14,17H2,1-2H3,(H,27,28,29)/b10-6+ |
| InChIKey | DHNRLOMLWSEAPI-UXBLZVDNSA-N |
| XLogP | 3.93 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|