C27H31N5O4 — CID 121031969
(E)-3-(3,4-dimethoxyphenyl)-1-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 121031969) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 121031969 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(Nc2cc(C)nc(N3CCN(C(=O)/C=C/c4ccc(OC)c(OC)c4)CC3)n2)cc1 |
| InChI | InChI=1S/C27H31N5O4/c1-19-17-25(29-21-7-9-22(34-2)10-8-21)30-27(28-19)32-15-13-31(14-16-32)26(33)12-6-20-5-11-23(35-3)24(18-20)36-4/h5-12,17-18H,13-16H2,1-4H3,(H,28,29,30)/b12-6+ |
| InChIKey | MOXIAQOSWQLJSY-WUXMJOGZSA-N |
| XLogP | 3.92 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|