C26H29N5O4 — CID 122325963
(E)-3-(3,4-dimethoxyphenyl)-N-[4-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]prop-2-enamide (PubChem CID 122325963) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[4-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[4-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122325963 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[4-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc(Nc3cc(C)nc(N4CCOCC4)n3)cc2)cc1OC |
| InChI | InChI=1S/C26H29N5O4/c1-18-16-24(30-26(27-18)31-12-14-35-15-13-31)28-20-6-8-21(9-7-20)29-25(32)11-5-19-4-10-22(33-2)23(17-19)34-3/h4-11,16-17H,12-15H2,1-3H3,(H,29,32)(H,27,28,30)/b11-5+ |
| InChIKey | SGXQNOMCYIVQJQ-VZUCSPMQSA-N |
| XLogP | 4.03 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|