C26H27N5O4 — CID 122346585
(E)-3-(1,3-benzodioxol-5-yl)-1-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 122346585) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122346585 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(Nc2cc(C)nc(N3CCN(C(=O)/C=C/c4ccc5c(c4)OCO5)CC3)n2)cc1 |
| InChI | InChI=1S/C26H27N5O4/c1-18-15-24(28-20-5-7-21(33-2)8-6-20)29-26(27-18)31-13-11-30(12-14-31)25(32)10-4-19-3-9-22-23(16-19)35-17-34-22/h3-10,15-16H,11-14,17H2,1-2H3,(H,27,28,29)/b10-4+ |
| InChIKey | SJOIKQXNKPAYJO-ONNFQVAWSA-N |
| XLogP | 3.63 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|