C28H25N5O4 — CID 122287014
(E)-3-(1,3-benzodioxol-5-yl)-N-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 122287014) has the molecular formula C28H25N5O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122287014 |
| Molecular Formula | C28H25N5O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[4-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | COc1ccc(Nc2cc(C)nc(Nc3ccc(NC(=O)/C=C/c4ccc5c(c4)OCO5)cc3)n2)cc1 |
| InChI | InChI=1S/C28H25N5O4/c1-18-15-26(30-20-9-11-23(35-2)12-10-20)33-28(29-18)32-22-7-5-21(6-8-22)31-27(34)14-4-19-3-13-24-25(16-19)37-17-36-24/h3-16H,17H2,1-2H3,(H,31,34)(H2,29,30,32,33)/b14-4+ |
| InChIKey | BUAMXQHVACRJEJ-LNKIKWGQSA-N |
| XLogP | 5.66 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|