C25H20N4O4 — CID 4640056
3-(1,3-benzodioxol-5-yl)-N-[4-[5-(4-methoxyphenyl)triazol-1-yl]phenyl]prop-2-enamide (PubChem CID 4640056) has the molecular formula C25H20N4O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[4-[5-(4-methoxyphenyl)triazol-1-yl]phenyl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[4-[5-(4-methoxyphenyl)triazol-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4640056 |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[4-[5-(4-methoxyphenyl)triazol-1-yl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(-c2cnnn2-c2ccc(NC(=O)C=Cc3ccc4c(c3)OCO4)cc2)cc1 |
| InChI | InChI=1S/C25H20N4O4/c1-31-21-10-4-18(5-11-21)22-15-26-28-29(22)20-8-6-19(7-9-20)27-25(30)13-3-17-2-12-23-24(14-17)33-16-32-23/h2-15H,16H2,1H3,(H,27,30) |
| InChIKey | UZGZUVWBYHMIGL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|