C21H17N3O3S — CID 117054841
(E)-3-(1,3-benzodioxol-5-yl)-N-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenyl]prop-2-enamide (PubChem CID 117054841) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 117054841 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)Nc1ccc(C2=CSC3=NCCN23)cc1 |
| InChI | InChI=1S/C21H17N3O3S/c25-20(8-2-14-1-7-18-19(11-14)27-13-26-18)23-16-5-3-15(4-6-16)17-12-28-21-22-9-10-24(17)21/h1-8,11-12H,9-10,13H2,(H,23,25)/b8-2+ |
| InChIKey | WTMIPQHWDWTIMZ-KRXBUXKQSA-N |
| XLogP | 3.78 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|