C23H25N5OS — CID 122346340
(E)-1-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 122346340) has the molecular formula C23H25N5OS and a molecular weight of 419.55 g/mol. Its IUPAC name is (E)-1-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 122346340 |
| Molecular Formula | C23H25N5OS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (E)-1-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | Cc1ccc(Nc2cc(C)nc(N3CCN(C(=O)/C=C/c4cccs4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H25N5OS/c1-17-5-7-19(8-6-17)25-21-16-18(2)24-23(26-21)28-13-11-27(12-14-28)22(29)10-9-20-4-3-15-30-20/h3-10,15-16H,11-14H2,1-2H3,(H,24,25,26)/b10-9+ |
| InChIKey | XDPBKADLNWVIBB-MDZDMXLPSA-N |
| XLogP | 4.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|