C23H25FN6O — CID 22585337
N-(4-fluorophenyl)-4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazine-1-carboxamide (PubChem CID 22585337) has the molecular formula C23H25FN6O and a molecular weight of 420.49 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazine-1-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 22585337 |
| Molecular Formula | C23H25FN6O |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-(4-fluorophenyl)-4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(N3CCN(C(=O)Nc4ccc(F)cc4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H25FN6O/c1-16-3-7-19(8-4-16)26-21-15-17(2)25-22(28-21)29-11-13-30(14-12-29)23(31)27-20-9-5-18(24)6-10-20/h3-10,15H,11-14H2,1-2H3,(H,27,31)(H,25,26,28) |
| InChIKey | DDIRKEPWTGYAEL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |