C22H24N6O — CID 22585325
4-(4-anilino-6-methylpyrimidin-2-yl)-N-phenylpiperazine-1-carboxamide (PubChem CID 22585325) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 4-(4-anilino-6-methylpyrimidin-2-yl)-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-(4-anilino-6-methylpyrimidin-2-yl)-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 22585325 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-(4-anilino-6-methylpyrimidin-2-yl)-N-phenylpiperazine-1-carboxamide |
| SMILES | Cc1cc(Nc2ccccc2)nc(N2CCN(C(=O)Nc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C22H24N6O/c1-17-16-20(24-18-8-4-2-5-9-18)26-21(23-17)27-12-14-28(15-13-27)22(29)25-19-10-6-3-7-11-19/h2-11,16H,12-15H2,1H3,(H,25,29)(H,23,24,26) |
| InChIKey | HDKBXGLOGVHBKW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |