C17H23N5O2S — CID 53093475
2-(4-ethylsulfonylpiperazin-1-yl)-6-methyl-N-phenylpyrimidin-4-amine (PubChem CID 53093475) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-(4-ethylsulfonylpiperazin-1-yl)-6-methyl-N-phenylpyrimidin-4-amine.
| Compound Name | 2-(4-ethylsulfonylpiperazin-1-yl)-6-methyl-N-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 53093475 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-(4-ethylsulfonylpiperazin-1-yl)-6-methyl-N-phenylpyrimidin-4-amine |
| SMILES | CCS(=O)(=O)N1CCN(c2nc(C)cc(Nc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C17H23N5O2S/c1-3-25(23,24)22-11-9-21(10-12-22)17-18-14(2)13-16(20-17)19-15-7-5-4-6-8-15/h4-8,13H,3,9-12H2,1-2H3,(H,18,19,20) |
| InChIKey | HLFHMBKPBHZJEI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |