C21H22BrN5O2S — CID 44826804
2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-6-methyl-N-phenylpyrimidin-4-amine (PubChem CID 44826804) has the molecular formula C21H22BrN5O2S and a molecular weight of 488.41 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-6-methyl-N-phenylpyrimidin-4-amine.
| Compound Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-6-methyl-N-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 44826804 |
| Molecular Formula | C21H22BrN5O2S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-6-methyl-N-phenylpyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccccc2)nc(N2CCN(S(=O)(=O)c3ccc(Br)cc3)CC2)n1 |
| InChI | InChI=1S/C21H22BrN5O2S/c1-16-15-20(24-18-5-3-2-4-6-18)25-21(23-16)26-11-13-27(14-12-26)30(28,29)19-9-7-17(22)8-10-19/h2-10,15H,11-14H2,1H3,(H,23,24,25) |
| InChIKey | ITMXONPTVRYZOS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |