C26H27N5O2S — CID 134410110
6-methyl-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-naphthalen-2-ylpyrimidin-4-amine (PubChem CID 134410110) has the molecular formula C26H27N5O2S and a molecular weight of 473.60 g/mol. Its IUPAC name is 6-methyl-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-naphthalen-2-ylpyrimidin-4-amine.
| Compound Name | 6-methyl-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-naphthalen-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 134410110 |
| Molecular Formula | C26H27N5O2S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 6-methyl-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-naphthalen-2-ylpyrimidin-4-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3nc(C)cc(Nc4ccc5ccccc5c4)n3)CC2)cc1 |
| InChI | InChI=1S/C26H27N5O2S/c1-19-7-11-24(12-8-19)34(32,33)31-15-13-30(14-16-31)26-27-20(2)17-25(29-26)28-23-10-9-21-5-3-4-6-22(21)18-23/h3-12,17-18H,13-16H2,1-2H3,(H,27,28,29) |
| InChIKey | JTVJSNNVIKCMAF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |