C23H22N6O3 — CID 122347617
(E)-3-(1,3-benzodioxol-5-yl)-1-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 122347617) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122347617 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)N1CCN(c2ccc(Nc3cccnc3)nn2)CC1 |
| InChI | InChI=1S/C23H22N6O3/c30-23(8-4-17-3-5-19-20(14-17)32-16-31-19)29-12-10-28(11-13-29)22-7-6-21(26-27-22)25-18-2-1-9-24-15-18/h1-9,14-15H,10-13,16H2,(H,25,26)/b8-4+ |
| InChIKey | QJMAEIJAQDZKBE-XBXARRHUSA-N |
| XLogP | 2.71 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|