C14H11Cl2NO2 — CID 118679067
1-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one (PubChem CID 118679067) has the molecular formula C14H11Cl2NO2 and a molecular weight of 296.15 g/mol. Its IUPAC name is 1-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one.
| Compound Name | 1-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 118679067 |
| Molecular Formula | C14H11Cl2NO2 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 1-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCCN1C(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2NO2/c15-11-6-4-10(12(16)9-11)5-7-14(19)17-8-2-1-3-13(17)18/h1,3-7,9H,2,8H2/b7-5+ |
| InChIKey | BFBNXWNNHAKRJK-FNORWQNLSA-N |
| XLogP | 3.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|