C14H9Cl2NO2 — CID 82062228
1-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]pyrrole-2-carbaldehyde (PubChem CID 82062228) has the molecular formula C14H9Cl2NO2 and a molecular weight of 294.14 g/mol. Its IUPAC name is 1-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]pyrrole-2-carbaldehyde.
| Compound Name | 1-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 82062228 |
| Molecular Formula | C14H9Cl2NO2 |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 1-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]pyrrole-2-carbaldehyde |
| SMILES | O=Cc1cccn1C(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl2NO2/c15-11-5-3-10(13(16)8-11)4-6-14(19)17-7-1-2-12(17)9-18/h1-9H/b6-4+ |
| InChIKey | IVXVWBZKXZBARV-GQCTYLIASA-N |
| XLogP | 3.96 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|