C16H20N2O — CID 39256784
(2E,4E)-4-methyl-5-phenyl-1-piperazin-1-ylpenta-2,4-dien-1-one (PubChem CID 39256784) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (2E,4E)-4-methyl-5-phenyl-1-piperazin-1-ylpenta-2,4-dien-1-one.
| Compound Name | (2E,4E)-4-methyl-5-phenyl-1-piperazin-1-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 39256784 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (2E,4E)-4-methyl-5-phenyl-1-piperazin-1-ylpenta-2,4-dien-1-one |
| SMILES | CC(/C=C/C(=O)N1CCNCC1)=C\c1ccccc1 |
| InChI | InChI=1S/C16H20N2O/c1-14(13-15-5-3-2-4-6-15)7-8-16(19)18-11-9-17-10-12-18/h2-8,13,17H,9-12H2,1H3/b8-7+,14-13+ |
| InChIKey | ZMJWUNARXUEDQB-SCCLZRITSA-N |
| XLogP | 2.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|