About 2-methylfuran;1-piperazin-1-ylethanone
2-methylfuran;1-piperazin-1-ylethanone (PubChem CID 143298157) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-methylfuran;1-piperazin-1-ylethanone.
Molecular Properties
| Compound Name | 2-methylfuran;1-piperazin-1-ylethanone |
| PubChem CID | 143298157 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-methylfuran;1-piperazin-1-ylethanone |
| SMILES | CC(=O)N1CCNCC1.Cc1ccco1 |
| InChI | InChI=1S/C6H12N2O.C5H6O/c1-6(9)8-4-2-7-3-5-8;1-5-3-2-4-6-5/h7H,2-5H2,1H3;2-4H,1H3 |
| InChIKey | RHLNYWJVNCFVBR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylfuran;1-piperazin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylfuran;1-piperazin-1-ylethanone?
The IUPAC name of 2-methylfuran;1-piperazin-1-ylethanone (CID 143298157) is 2-methylfuran;1-piperazin-1-ylethanone.
What is the SMILES notation for 2-methylfuran;1-piperazin-1-ylethanone?
The canonical SMILES for 2-methylfuran;1-piperazin-1-ylethanone is CC(=O)N1CCNCC1.Cc1ccco1.
What is the InChIKey of 2-methylfuran;1-piperazin-1-ylethanone?
The InChIKey is RHLNYWJVNCFVBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C5H6O/c1-6(9)8-4-2-7-3-5-8;1-5-3-2-4-6-5/h7H,2-5H2,1H3;2-4H,1H3.
What are the key properties of 2-methylfuran;1-piperazin-1-ylethanone?
2-methylfuran;1-piperazin-1-ylethanone has a molecular weight of 210.28 g/mol, XLogP of 1.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylfuran;1-piperazin-1-ylethanone is sourced from PubChem (CID 143298157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).