About 3-fluoroaniline;1-piperazin-1-ylethanone
3-fluoroaniline;1-piperazin-1-ylethanone (PubChem CID 69484090) has the molecular formula C12H18FN3O
and a molecular weight of 239.29 g/mol. Its IUPAC name is 3-fluoroaniline;1-piperazin-1-ylethanone.
Molecular Properties
| Compound Name | 3-fluoroaniline;1-piperazin-1-ylethanone |
| PubChem CID | 69484090 |
| Molecular Formula | C12H18FN3O |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 3-fluoroaniline;1-piperazin-1-ylethanone |
| SMILES | CC(=O)N1CCNCC1.Nc1cccc(F)c1 |
| InChI | InChI=1S/C6H6FN.C6H12N2O/c7-5-2-1-3-6(8)4-5;1-6(9)8-4-2-7-3-5-8/h1-4H,8H2;7H,2-5H2,1H3 |
| InChIKey | JFNIZAHHWFGTMJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoroaniline;1-piperazin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoroaniline;1-piperazin-1-ylethanone?
The IUPAC name of 3-fluoroaniline;1-piperazin-1-ylethanone (CID 69484090) is 3-fluoroaniline;1-piperazin-1-ylethanone.
What is the SMILES notation for 3-fluoroaniline;1-piperazin-1-ylethanone?
The canonical SMILES for 3-fluoroaniline;1-piperazin-1-ylethanone is CC(=O)N1CCNCC1.Nc1cccc(F)c1.
What is the InChIKey of 3-fluoroaniline;1-piperazin-1-ylethanone?
The InChIKey is JFNIZAHHWFGTMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN.C6H12N2O/c7-5-2-1-3-6(8)4-5;1-6(9)8-4-2-7-3-5-8/h1-4H,8H2;7H,2-5H2,1H3.
What are the key properties of 3-fluoroaniline;1-piperazin-1-ylethanone?
3-fluoroaniline;1-piperazin-1-ylethanone has a molecular weight of 239.29 g/mol, XLogP of 0.85, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoroaniline;1-piperazin-1-ylethanone is sourced from PubChem (CID 69484090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).