About 2-fluoroacetic acid;3-fluoroaniline
2-fluoroacetic acid;3-fluoroaniline (PubChem CID 174793290) has the molecular formula C8H9F2NO2
and a molecular weight of 189.16 g/mol. Its IUPAC name is 2-fluoroacetic acid;3-fluoroaniline.
Molecular Properties
| Compound Name | 2-fluoroacetic acid;3-fluoroaniline |
| PubChem CID | 174793290 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-fluoroacetic acid;3-fluoroaniline |
| SMILES | Nc1cccc(F)c1.O=C(O)CF |
| InChI | InChI=1S/C6H6FN.C2H3FO2/c7-5-2-1-3-6(8)4-5;3-1-2(4)5/h1-4H,8H2;1H2,(H,4,5) |
| InChIKey | AYAPETJBDLCTLO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroacetic acid;3-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroacetic acid;3-fluoroaniline?
The IUPAC name of 2-fluoroacetic acid;3-fluoroaniline (CID 174793290) is 2-fluoroacetic acid;3-fluoroaniline.
What is the SMILES notation for 2-fluoroacetic acid;3-fluoroaniline?
The canonical SMILES for 2-fluoroacetic acid;3-fluoroaniline is Nc1cccc(F)c1.O=C(O)CF.
What is the InChIKey of 2-fluoroacetic acid;3-fluoroaniline?
The InChIKey is AYAPETJBDLCTLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN.C2H3FO2/c7-5-2-1-3-6(8)4-5;3-1-2(4)5/h1-4H,8H2;1H2,(H,4,5).
What are the key properties of 2-fluoroacetic acid;3-fluoroaniline?
2-fluoroacetic acid;3-fluoroaniline has a molecular weight of 189.16 g/mol, XLogP of 1.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroacetic acid;3-fluoroaniline is sourced from PubChem (CID 174793290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).