C9H11FN6 — CID 162739676
3-fluoroaniline;4-iminopyrazole-3,5-diamine (PubChem CID 162739676) has the molecular formula C9H11FN6 and a molecular weight of 222.23 g/mol. Its IUPAC name is 3-fluoroaniline;4-iminopyrazole-3,5-diamine.
| Compound Name | 3-fluoroaniline;4-iminopyrazole-3,5-diamine |
|---|---|
| PubChem CID | 162739676 |
| Molecular Formula | C9H11FN6 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3-fluoroaniline;4-iminopyrazole-3,5-diamine |
| SMILES | Nc1cccc(F)c1.[H]N=C1C(N)=NN=C1N |
| InChI | InChI=1S/C6H6FN.C3H5N5/c7-5-2-1-3-6(8)4-5;4-1-2(5)7-8-3(1)6/h1-4H,8H2;(H5,4,5,6,7,8) |
| InChIKey | UTJUMSWRXKJGJO-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|