About 3-fluoroaniline;pyrrolidin-2-ylmethanol
3-fluoroaniline;pyrrolidin-2-ylmethanol (PubChem CID 69484506) has the molecular formula C11H17FN2O
and a molecular weight of 212.27 g/mol. Its IUPAC name is 3-fluoroaniline;pyrrolidin-2-ylmethanol.
Molecular Properties
| Compound Name | 3-fluoroaniline;pyrrolidin-2-ylmethanol |
| PubChem CID | 69484506 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-fluoroaniline;pyrrolidin-2-ylmethanol |
| SMILES | Nc1cccc(F)c1.OCC1CCCN1 |
| InChI | InChI=1S/C6H6FN.C5H11NO/c7-5-2-1-3-6(8)4-5;7-4-5-2-1-3-6-5/h1-4H,8H2;5-7H,1-4H2 |
| InChIKey | OHIYWOPVBDQWEM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoroaniline;pyrrolidin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoroaniline;pyrrolidin-2-ylmethanol?
The IUPAC name of 3-fluoroaniline;pyrrolidin-2-ylmethanol (CID 69484506) is 3-fluoroaniline;pyrrolidin-2-ylmethanol.
What is the SMILES notation for 3-fluoroaniline;pyrrolidin-2-ylmethanol?
The canonical SMILES for 3-fluoroaniline;pyrrolidin-2-ylmethanol is Nc1cccc(F)c1.OCC1CCCN1.
What is the InChIKey of 3-fluoroaniline;pyrrolidin-2-ylmethanol?
The InChIKey is OHIYWOPVBDQWEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN.C5H11NO/c7-5-2-1-3-6(8)4-5;7-4-5-2-1-3-6-5/h1-4H,8H2;5-7H,1-4H2.
What are the key properties of 3-fluoroaniline;pyrrolidin-2-ylmethanol?
3-fluoroaniline;pyrrolidin-2-ylmethanol has a molecular weight of 212.27 g/mol, XLogP of 1.14, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoroaniline;pyrrolidin-2-ylmethanol is sourced from PubChem (CID 69484506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).