About cumene;pyrrolidin-2-ylmethanol
cumene;pyrrolidin-2-ylmethanol (PubChem CID 142237933) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is cumene;pyrrolidin-2-ylmethanol.
Molecular Properties
| Compound Name | cumene;pyrrolidin-2-ylmethanol |
| PubChem CID | 142237933 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | cumene;pyrrolidin-2-ylmethanol |
| SMILES | CC(C)c1ccccc1.OCC1CCCN1 |
| InChI | InChI=1S/C9H12.C5H11NO/c1-8(2)9-6-4-3-5-7-9;7-4-5-2-1-3-6-5/h3-8H,1-2H3;5-7H,1-4H2 |
| InChIKey | GAQVEACQYQPHKK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cumene;pyrrolidin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;pyrrolidin-2-ylmethanol?
The IUPAC name of cumene;pyrrolidin-2-ylmethanol (CID 142237933) is cumene;pyrrolidin-2-ylmethanol.
What is the SMILES notation for cumene;pyrrolidin-2-ylmethanol?
The canonical SMILES for cumene;pyrrolidin-2-ylmethanol is CC(C)c1ccccc1.OCC1CCCN1.
What is the InChIKey of cumene;pyrrolidin-2-ylmethanol?
The InChIKey is GAQVEACQYQPHKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C5H11NO/c1-8(2)9-6-4-3-5-7-9;7-4-5-2-1-3-6-5/h3-8H,1-2H3;5-7H,1-4H2.
What are the key properties of cumene;pyrrolidin-2-ylmethanol?
cumene;pyrrolidin-2-ylmethanol has a molecular weight of 221.34 g/mol, XLogP of 2.54, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;pyrrolidin-2-ylmethanol is sourced from PubChem (CID 142237933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).