About cumene;4-methylpiperidine
cumene;4-methylpiperidine (PubChem CID 158684278) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is cumene;4-methylpiperidine.
Molecular Properties
| Compound Name | cumene;4-methylpiperidine |
| PubChem CID | 158684278 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | cumene;4-methylpiperidine |
| SMILES | CC(C)c1ccccc1.CC1CCNCC1 |
| InChI | InChI=1S/C9H12.C6H13N/c1-8(2)9-6-4-3-5-7-9;1-6-2-4-7-5-3-6/h3-8H,1-2H3;6-7H,2-5H2,1H3 |
| InChIKey | IFNMGKVLLMBXPR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cumene;4-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;4-methylpiperidine?
The IUPAC name of cumene;4-methylpiperidine (CID 158684278) is cumene;4-methylpiperidine.
What is the SMILES notation for cumene;4-methylpiperidine?
The canonical SMILES for cumene;4-methylpiperidine is CC(C)c1ccccc1.CC1CCNCC1.
What is the InChIKey of cumene;4-methylpiperidine?
The InChIKey is IFNMGKVLLMBXPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C6H13N/c1-8(2)9-6-4-3-5-7-9;1-6-2-4-7-5-3-6/h3-8H,1-2H3;6-7H,2-5H2,1H3.
What are the key properties of cumene;4-methylpiperidine?
cumene;4-methylpiperidine has a molecular weight of 219.37 g/mol, XLogP of 3.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;4-methylpiperidine is sourced from PubChem (CID 158684278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).