About 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol
1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol (PubChem CID 142267909) has the molecular formula C12H27NO
and a molecular weight of 201.35 g/mol. Its IUPAC name is 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol |
| PubChem CID | 142267909 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol |
| SMILES | CC.CC1(C)CC1.OC[C@@H]1CCCN1 |
| InChI | InChI=1S/C5H11NO.C5H10.C2H6/c7-4-5-2-1-3-6-5;1-5(2)3-4-5;1-2/h5-7H,1-4H2;3-4H2,1-2H3;1-2H3/t5-;;/m0../s1 |
| InChIKey | CZNNLSPPTKNELY-XRIGFGBMSA-N |
| XLogP | 2.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol?
The IUPAC name of 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol (CID 142267909) is 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol.
What is the SMILES notation for 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol?
The canonical SMILES for 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol is CC.CC1(C)CC1.OC[C@@H]1CCCN1.
What is the InChIKey of 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol?
The InChIKey is CZNNLSPPTKNELY-XRIGFGBMSA-N. The full InChI is InChI=1S/C5H11NO.C5H10.C2H6/c7-4-5-2-1-3-6-5;1-5(2)3-4-5;1-2/h5-7H,1-4H2;3-4H2,1-2H3;1-2H3/t5-;;/m0../s1.
What are the key properties of 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol?
1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol has a molecular weight of 201.35 g/mol, XLogP of 2.56, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylcyclopropane;ethane;[(2S)-pyrrolidin-2-yl]methanol is sourced from PubChem (CID 142267909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).