C8H14N2O — CID 121370345
1-[(6E)-2,3,5,8-tetrahydro-1H-1,4-diazocin-4-yl]ethanone (PubChem CID 121370345) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-[(6E)-2,3,5,8-tetrahydro-1H-1,4-diazocin-4-yl]ethanone.
| Compound Name | 1-[(6E)-2,3,5,8-tetrahydro-1H-1,4-diazocin-4-yl]ethanone |
|---|---|
| PubChem CID | 121370345 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-[(6E)-2,3,5,8-tetrahydro-1H-1,4-diazocin-4-yl]ethanone |
| SMILES | CC(=O)N1C/C=C\CNCC1 |
| InChI | InChI=1S/C8H14N2O/c1-8(11)10-6-3-2-4-9-5-7-10/h2-3,9H,4-7H2,1H3/b3-2- |
| InChIKey | IPQLATIQVYDOLU-IHWYPQMZSA-N |
| XLogP | -0.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|