About S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone
S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone (PubChem CID 160844341) has the molecular formula C18H31N5O4S
and a molecular weight of 413.54 g/mol. Its IUPAC name is S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone.
Molecular Properties
| Compound Name | S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone |
| PubChem CID | 160844341 |
| Molecular Formula | C18H31N5O4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone |
| SMILES | CC(=O)N1CCNCC1.CC(=O)SC1CN(C(=O)N2CCN(C(C)=O)CC2)C1 |
| InChI | InChI=1S/C12H19N3O3S.C6H12N2O/c1-9(16)13-3-5-14(6-4-13)12(18)15-7-11(8-15)19-10(2)17;1-6(9)8-4-2-7-3-5-8/h11H,3-8H2,1-2H3;7H,2-5H2,1H3 |
| InChIKey | SILGGHZRFHQPTB-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone?
The IUPAC name of S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone (CID 160844341) is S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone.
What is the SMILES notation for S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone?
The canonical SMILES for S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone is CC(=O)N1CCNCC1.CC(=O)SC1CN(C(=O)N2CCN(C(C)=O)CC2)C1.
What is the InChIKey of S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone?
The InChIKey is SILGGHZRFHQPTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3S.C6H12N2O/c1-9(16)13-3-5-14(6-4-13)12(18)15-7-11(8-15)19-10(2)17;1-6(9)8-4-2-7-3-5-8/h11H,3-8H2,1-2H3;7H,2-5H2,1H3.
What are the key properties of S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone?
S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone has a molecular weight of 413.54 g/mol, XLogP of -0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[1-(4-acetylpiperazine-1-carbonyl)azetidin-3-yl] ethanethioate;1-piperazin-1-ylethanone is sourced from PubChem (CID 160844341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).