C9H12Cl2N2O2 — CID 2129461
1-[(1R)-2,2-dichlorocyclopropanecarbonyl]-1,4-diazepan-5-one (PubChem CID 2129461) has the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. Its IUPAC name is 1-[(1R)-2,2-dichlorocyclopropanecarbonyl]-1,4-diazepan-5-one.
| Compound Name | 1-[(1R)-2,2-dichlorocyclopropanecarbonyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 2129461 |
| Molecular Formula | C9H12Cl2N2O2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 1-[(1R)-2,2-dichlorocyclopropanecarbonyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)[C@H]2CC2(Cl)Cl)CCN1 |
| InChI | InChI=1S/C9H12Cl2N2O2/c10-9(11)5-6(9)8(15)13-3-1-7(14)12-2-4-13/h6H,1-5H2,(H,12,14)/t6-/m1/s1 |
| InChIKey | KGPHJAGOYUIDDB-ZCFIWIBFSA-N |
| XLogP | 0.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|