C10H16N2O3 — CID 60707955
1-(oxolane-2-carbonyl)-1,4-diazepan-5-one (PubChem CID 60707955) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-(oxolane-2-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 1-(oxolane-2-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 60707955 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-(oxolane-2-carbonyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)C2CCCO2)CCN1 |
| InChI | InChI=1S/C10H16N2O3/c13-9-3-5-12(6-4-11-9)10(14)8-2-1-7-15-8/h8H,1-7H2,(H,11,13) |
| InChIKey | GFFGPTFASSTTRR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |