C10H16N2O3 — CID 103872787
4-[(2S)-oxolane-2-carbonyl]-1,4-diazepan-2-one (PubChem CID 103872787) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-[(2S)-oxolane-2-carbonyl]-1,4-diazepan-2-one.
| Compound Name | 4-[(2S)-oxolane-2-carbonyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 103872787 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 4-[(2S)-oxolane-2-carbonyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)[C@@H]2CCCO2)CCCN1 |
| InChI | InChI=1S/C10H16N2O3/c13-9-7-12(5-2-4-11-9)10(14)8-3-1-6-15-8/h8H,1-7H2,(H,11,13)/t8-/m0/s1 |
| InChIKey | BMSSSGBHDCVTGK-QMMMGPOBSA-N |
| XLogP | -0.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |