C12H21N3O2 — CID 65366220
4-(4-aminocyclohexanecarbonyl)-1,4-diazepan-2-one (PubChem CID 65366220) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-(4-aminocyclohexanecarbonyl)-1,4-diazepan-2-one.
| Compound Name | 4-(4-aminocyclohexanecarbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65366220 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 4-(4-aminocyclohexanecarbonyl)-1,4-diazepan-2-one |
| SMILES | NC1CCC(C(=O)N2CCCNC(=O)C2)CC1 |
| InChI | InChI=1S/C12H21N3O2/c13-10-4-2-9(3-5-10)12(17)15-7-1-6-14-11(16)8-15/h9-10H,1-8,13H2,(H,14,16) |
| InChIKey | YEUDLXDLGOLPJZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |