C10H16N2O4S — CID 62896081
4-(1,1-dioxothiolane-3-carbonyl)-1,4-diazepan-2-one (PubChem CID 62896081) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 4-(1,1-dioxothiolane-3-carbonyl)-1,4-diazepan-2-one.
| Compound Name | 4-(1,1-dioxothiolane-3-carbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 62896081 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-(1,1-dioxothiolane-3-carbonyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)C2CCS(=O)(=O)C2)CCCN1 |
| InChI | InChI=1S/C10H16N2O4S/c13-9-6-12(4-1-3-11-9)10(14)8-2-5-17(15,16)7-8/h8H,1-7H2,(H,11,13) |
| InChIKey | MZRVKONMULWRAE-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |