C11H20N2O2 — CID 63863884
(3,5-dimethylpiperazin-1-yl)-(oxolan-2-yl)methanone (PubChem CID 63863884) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3,5-dimethylpiperazin-1-yl)-(oxolan-2-yl)methanone.
| Compound Name | (3,5-dimethylpiperazin-1-yl)-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 63863884 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (3,5-dimethylpiperazin-1-yl)-(oxolan-2-yl)methanone |
| SMILES | CC1CN(C(=O)C2CCCO2)CC(C)N1 |
| InChI | InChI=1S/C11H20N2O2/c1-8-6-13(7-9(2)12-8)11(14)10-4-3-5-15-10/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | IUBLAAPUXVEJJJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |