C10H17NO4 — CID 79403349
[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-(oxan-2-yl)methanone (PubChem CID 79403349) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is [(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-(oxan-2-yl)methanone.
| Compound Name | [(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-(oxan-2-yl)methanone |
|---|---|
| PubChem CID | 79403349 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | [(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-(oxan-2-yl)methanone |
| SMILES | O=C(C1CCCCO1)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H17NO4/c12-7-5-11(6-8(7)13)10(14)9-3-1-2-4-15-9/h7-9,12-13H,1-6H2/t7-,8+,9? |
| InChIKey | WFIRKNMQYPIANR-JVHMLUBASA-N |
| XLogP | -0.88 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |