C12H21N3O4S — CID 62045564
1-(1-methylsulfonylpiperidine-4-carbonyl)-1,4-diazepan-5-one (PubChem CID 62045564) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 1-(1-methylsulfonylpiperidine-4-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 1-(1-methylsulfonylpiperidine-4-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62045564 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1-(1-methylsulfonylpiperidine-4-carbonyl)-1,4-diazepan-5-one |
| SMILES | CS(=O)(=O)N1CCC(C(=O)N2CCNC(=O)CC2)CC1 |
| InChI | InChI=1S/C12H21N3O4S/c1-20(18,19)15-7-2-10(3-8-15)12(17)14-6-4-11(16)13-5-9-14/h10H,2-9H2,1H3,(H,13,16) |
| InChIKey | XGEHSKAMHDSSTA-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |