C12H14N2O2S — CID 55026077
1-[(E)-3-thiophen-2-ylprop-2-enoyl]-1,4-diazepan-5-one (PubChem CID 55026077) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 1-[(E)-3-thiophen-2-ylprop-2-enoyl]-1,4-diazepan-5-one.
| Compound Name | 1-[(E)-3-thiophen-2-ylprop-2-enoyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 55026077 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1-[(E)-3-thiophen-2-ylprop-2-enoyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)/C=C/c2cccs2)CCN1 |
| InChI | InChI=1S/C12H14N2O2S/c15-11-5-7-14(8-6-13-11)12(16)4-3-10-2-1-9-17-10/h1-4,9H,5-8H2,(H,13,15)/b4-3+ |
| InChIKey | GCQXLOCPADAXSE-ONEGZZNKSA-N |
| XLogP | 1.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|