C28H26N4O3 — CID 23736786
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-pyridin-2-ylquinoline-4-carboxylate (PubChem CID 23736786) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-pyridin-2-ylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-pyridin-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 23736786 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2-pyridin-2-ylquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccccn2)nc2ccccc12)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H26N4O3/c33-27(30-20-11-13-21(14-12-20)32-16-6-1-7-17-32)19-35-28(34)23-18-26(25-10-4-5-15-29-25)31-24-9-3-2-8-22(23)24/h2-5,8-15,18H,1,6-7,16-17,19H2,(H,30,33) |
| InChIKey | CDNDSUJQGCBYOF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|