C22H17ClN2O6S4 — CID 25043128
(3-chlorophenyl)methyl 3,5-bis(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 25043128) has the molecular formula C22H17ClN2O6S4 and a molecular weight of 569.11 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 3,5-bis(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | (3-chlorophenyl)methyl 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 25043128 |
| Molecular Formula | C22H17ClN2O6S4 |
| Molecular Weight | 569.11 g/mol |
| Exact Mass | 567.97 |
| IUPAC Name | (3-chlorophenyl)methyl 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(OCc1cccc(Cl)c1)c1cc(NS(=O)(=O)c2cccs2)cc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C22H17ClN2O6S4/c23-17-5-1-4-15(10-17)14-31-22(26)16-11-18(24-34(27,28)20-6-2-8-32-20)13-19(12-16)25-35(29,30)21-7-3-9-33-21/h1-13,24-25H,14H2 |
| InChIKey | BVQWPTCRYGQVOX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.11 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |