C23H17N3O6S4 — CID 2412693
(4-cyanophenyl)methyl 3,5-bis(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 2412693) has the molecular formula C23H17N3O6S4 and a molecular weight of 559.67 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 3,5-bis(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | (4-cyanophenyl)methyl 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 2412693 |
| Molecular Formula | C23H17N3O6S4 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.00 |
| IUPAC Name | (4-cyanophenyl)methyl 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | N#Cc1ccc(COC(=O)c2cc(NS(=O)(=O)c3cccs3)cc(NS(=O)(=O)c3cccs3)c2)cc1 |
| InChI | InChI=1S/C23H17N3O6S4/c24-14-16-5-7-17(8-6-16)15-32-23(27)18-11-19(25-35(28,29)21-3-1-9-33-21)13-20(12-18)26-36(30,31)22-4-2-10-34-22/h1-13,25-26H,15H2 |
| InChIKey | LRCKWJRCZZXSTB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |