C21H19ClN2O7S — CID 3639253
2-(1,3-dioxoisoindol-2-yl)ethyl 1-(4-chlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 3639253) has the molecular formula C21H19ClN2O7S and a molecular weight of 478.91 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(4-chlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(4-chlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 3639253 |
| Molecular Formula | C21H19ClN2O7S |
| Molecular Weight | 478.91 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(4-chlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)C1CC(O)CN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN2O7S/c22-13-5-7-15(8-6-13)32(29,30)24-12-14(25)11-18(24)21(28)31-10-9-23-19(26)16-3-1-2-4-17(16)20(23)27/h1-8,14,18,25H,9-12H2 |
| InChIKey | CPHOVWSNRJFISA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.91 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|