C15H25ClN2O4S2 — CID 119975061
1-[1-[4-(methylsulfonylmethyl)phenyl]sulfonylpiperidin-4-yl]ethanamine;hydrochloride (PubChem CID 119975061) has the molecular formula C15H25ClN2O4S2 and a molecular weight of 396.96 g/mol. Its IUPAC name is 1-[1-[4-(methylsulfonylmethyl)phenyl]sulfonylpiperidin-4-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-[4-(methylsulfonylmethyl)phenyl]sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119975061 |
| Molecular Formula | C15H25ClN2O4S2 |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-[1-[4-(methylsulfonylmethyl)phenyl]sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCN(S(=O)(=O)c2ccc(CS(C)(=O)=O)cc2)CC1.Cl |
| InChI | InChI=1S/C15H24N2O4S2.ClH/c1-12(16)14-7-9-17(10-8-14)23(20,21)15-5-3-13(4-6-15)11-22(2,18)19;/h3-6,12,14H,7-11,16H2,1-2H3;1H |
| InChIKey | NEPPTADIJIANLT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |