C17H21NO4S2 — CID 90632498
4-(2-ethoxyphenyl)sulfonyl-7-(furan-2-yl)-1,4-thiazepane (PubChem CID 90632498) has the molecular formula C17H21NO4S2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)sulfonyl-7-(furan-2-yl)-1,4-thiazepane.
| Compound Name | 4-(2-ethoxyphenyl)sulfonyl-7-(furan-2-yl)-1,4-thiazepane |
|---|---|
| PubChem CID | 90632498 |
| Molecular Formula | C17H21NO4S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-(2-ethoxyphenyl)sulfonyl-7-(furan-2-yl)-1,4-thiazepane |
| SMILES | CCOc1ccccc1S(=O)(=O)N1CCSC(c2ccco2)CC1 |
| InChI | InChI=1S/C17H21NO4S2/c1-2-21-15-6-3-4-8-17(15)24(19,20)18-10-9-16(23-13-11-18)14-7-5-12-22-14/h3-8,12,16H,2,9-11,13H2,1H3 |
| InChIKey | FPKWOJAXWKSZCK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |