C16H18FNO5S2 — CID 90590680
1-(4-fluorophenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine (PubChem CID 90590680) has the molecular formula C16H18FNO5S2 and a molecular weight of 387.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine |
|---|---|
| PubChem CID | 90590680 |
| Molecular Formula | C16H18FNO5S2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-4-(furan-2-ylmethylsulfonyl)piperidine |
| SMILES | O=S(=O)(Cc1ccco1)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H18FNO5S2/c17-13-3-5-16(6-4-13)25(21,22)18-9-7-15(8-10-18)24(19,20)12-14-2-1-11-23-14/h1-6,11,15H,7-10,12H2 |
| InChIKey | HCHJMCMDTUHOEY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |