C12H19NO3S2 — CID 90632450
7-(furan-2-yl)-4-propylsulfonyl-1,4-thiazepane (PubChem CID 90632450) has the molecular formula C12H19NO3S2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 7-(furan-2-yl)-4-propylsulfonyl-1,4-thiazepane.
| Compound Name | 7-(furan-2-yl)-4-propylsulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 90632450 |
| Molecular Formula | C12H19NO3S2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 7-(furan-2-yl)-4-propylsulfonyl-1,4-thiazepane |
| SMILES | CCCS(=O)(=O)N1CCSC(c2ccco2)CC1 |
| InChI | InChI=1S/C12H19NO3S2/c1-2-10-18(14,15)13-6-5-12(17-9-7-13)11-4-3-8-16-11/h3-4,8,12H,2,5-7,9-10H2,1H3 |
| InChIKey | XESJCKPFISVWHV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |