C16H18FNO6S2 — CID 99873558
(3R)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(furan-2-ylmethylsulfonyl)pyrrolidine (PubChem CID 99873558) has the molecular formula C16H18FNO6S2 and a molecular weight of 403.45 g/mol. Its IUPAC name is (3R)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(furan-2-ylmethylsulfonyl)pyrrolidine.
| Compound Name | (3R)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(furan-2-ylmethylsulfonyl)pyrrolidine |
|---|---|
| PubChem CID | 99873558 |
| Molecular Formula | C16H18FNO6S2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | (3R)-1-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(furan-2-ylmethylsulfonyl)pyrrolidine |
| SMILES | COc1ccc(S(=O)(=O)N2CC[C@@H](S(=O)(=O)Cc3ccco3)C2)cc1F |
| InChI | InChI=1S/C16H18FNO6S2/c1-23-16-5-4-13(9-15(16)17)26(21,22)18-7-6-14(10-18)25(19,20)11-12-3-2-8-24-12/h2-5,8-9,14H,6-7,10-11H2,1H3/t14-/m1/s1 |
| InChIKey | OOQMDACPMYHMDP-CQSZACIVSA-N |
| XLogP | 1.81 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |